C21H23NO4 — CID 98139915
N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetamide (PubChem CID 98139915) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetamide.
| Compound Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetamide |
|---|---|
| PubChem CID | 98139915 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[[(1R,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2-(7-hydroxy-4,8-dimethyl-2-oxochromen-3-yl)acetamide |
| SMILES | Cc1c(CC(=O)NC[C@@H]2C[C@H]3C=C[C@H]2C3)c(=O)oc2c(C)c(O)ccc12 |
| InChI | InChI=1S/C21H23NO4/c1-11-16-5-6-18(23)12(2)20(16)26-21(25)17(11)9-19(24)22-10-15-8-13-3-4-14(15)7-13/h3-6,13-15,23H,7-10H2,1-2H3,(H,22,24)/t13-,14-,15-/m0/s1 |
| InChIKey | BUBBOUMWDGPJCZ-KKUMJFAQSA-N |
| XLogP | 2.99 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|