C13H14N4O — CID 98155311
(NE)-N-[(1S,3S,4R)-3-(benzotriazol-1-yl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 98155311) has the molecular formula C13H14N4O and a molecular weight of 242.28 g/mol. Its IUPAC name is (NE)-N-[(1S,3S,4R)-3-(benzotriazol-1-yl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1S,3S,4R)-3-(benzotriazol-1-yl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 98155311 |
| Molecular Formula | C13H14N4O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (NE)-N-[(1S,3S,4R)-3-(benzotriazol-1-yl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O/N=C1\[C@H]2CC[C@H](C2)[C@@H]1n1nnc2ccccc21 |
| InChI | InChI=1S/C13H14N4O/c18-15-12-8-5-6-9(7-8)13(12)17-11-4-2-1-3-10(11)14-16-17/h1-4,8-9,13,18H,5-7H2/b15-12+/t8-,9+,13-/m0/s1 |
| InChIKey | WOCIXQSQOSDECI-OMVSFJLLSA-N |
| XLogP | 2.23 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|