C24H31Cl2NO — CID 98419206
(1R)-2,2-dichloro-N-[[(5R,7R)-3-(3,4-dimethylphenyl)-1-adamantyl]methyl]-1-methylcyclopropane-1-carboxamide (PubChem CID 98419206) has the molecular formula C24H31Cl2NO and a molecular weight of 420.42 g/mol. Its IUPAC name is (1R)-2,2-dichloro-N-[[(5R,7R)-3-(3,4-dimethylphenyl)-1-adamantyl]methyl]-1-methylcyclopropane-1-carboxamide.
| Compound Name | (1R)-2,2-dichloro-N-[[(5R,7R)-3-(3,4-dimethylphenyl)-1-adamantyl]methyl]-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 98419206 |
| Molecular Formula | C24H31Cl2NO |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | (1R)-2,2-dichloro-N-[[(5R,7R)-3-(3,4-dimethylphenyl)-1-adamantyl]methyl]-1-methylcyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C23C[C@H]4C[C@@H](CC(CNC(=O)[C@@]5(C)CC5(Cl)Cl)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C24H31Cl2NO/c1-15-4-5-19(6-16(15)2)23-10-17-7-18(11-23)9-22(8-17,13-23)14-27-20(28)21(3)12-24(21,25)26/h4-6,17-18H,7-14H2,1-3H3,(H,27,28)/t17-,18-,21+,22?,23?/m0/s1 |
| InChIKey | YZMIMWHIZYRODV-OZIOPSNKSA-N |
| XLogP | 5.84 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|