C13H16ClN5O4 — CID 98461954
N'-[(Z)-[4-[(5-chloro-2-pyridinyl)amino]-4-oxobutan-2-ylidene]amino]-N-(2-hydroxyethyl)oxamide (PubChem CID 98461954) has the molecular formula C13H16ClN5O4 and a molecular weight of 341.76 g/mol. Its IUPAC name is N'-[(Z)-[4-[(5-chloro-2-pyridinyl)amino]-4-oxobutan-2-ylidene]amino]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[(Z)-[4-[(5-chloro-2-pyridinyl)amino]-4-oxobutan-2-ylidene]amino]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 98461954 |
| Molecular Formula | C13H16ClN5O4 |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N'-[(Z)-[4-[(5-chloro-2-pyridinyl)amino]-4-oxobutan-2-ylidene]amino]-N-(2-hydroxyethyl)oxamide |
| SMILES | C/C(CC(=O)Nc1ccc(Cl)cn1)=N/NC(=O)C(=O)NCCO |
| InChI | InChI=1S/C13H16ClN5O4/c1-8(18-19-13(23)12(22)15-4-5-20)6-11(21)17-10-3-2-9(14)7-16-10/h2-3,7,20H,4-6H2,1H3,(H,15,22)(H,19,23)(H,16,17,21)/b18-8- |
| InChIKey | UBOQGVJRLMGAIB-LSCVHKIXSA-N |
| XLogP | -0.34 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|