C24H24O9 — CID 98526338
(3S)-3-[(1E,5E,9Z)-6,9-bis[(3S)-2,5-dioxooxolan-3-yl]cyclododeca-1,5,9-trien-1-yl]oxolane-2,5-dione (PubChem CID 98526338) has the molecular formula C24H24O9 and a molecular weight of 456.45 g/mol. Its IUPAC name is (3S)-3-[(1E,5E,9Z)-6,9-bis[(3S)-2,5-dioxooxolan-3-yl]cyclododeca-1,5,9-trien-1-yl]oxolane-2,5-dione.
| Compound Name | (3S)-3-[(1E,5E,9Z)-6,9-bis[(3S)-2,5-dioxooxolan-3-yl]cyclododeca-1,5,9-trien-1-yl]oxolane-2,5-dione |
|---|---|
| PubChem CID | 98526338 |
| Molecular Formula | C24H24O9 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | (3S)-3-[(1E,5E,9Z)-6,9-bis[(3S)-2,5-dioxooxolan-3-yl]cyclododeca-1,5,9-trien-1-yl]oxolane-2,5-dione |
| SMILES | O=C1C[C@@H](/C2=C\CC/C([C@@H]3CC(=O)OC3=O)=C\CC/C=C(/[C@@H]3CC(=O)OC3=O)CC2)C(=O)O1 |
| InChI | InChI=1S/C24H24O9/c25-19-10-16(22(28)31-19)13-4-1-2-5-14(17-11-20(26)32-23(17)29)8-9-15(7-3-6-13)18-12-21(27)33-24(18)30/h4-5,7,16-18H,1-3,6,8-12H2/b13-4+,14-5+,15-7-/t16-,17-,18-/m0/s1 |
| InChIKey | NIAQVKOACRJZMV-BILASMFTSA-N |
| XLogP | 2.39 |
| TPSA | 130.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|