C25H20O2 — CID 98547990
(4E,6Z)-1,5,7-triphenylhepta-4,6-diene-1,3-dione (PubChem CID 98547990) has the molecular formula C25H20O2 and a molecular weight of 352.43 g/mol. Its IUPAC name is (4E,6Z)-1,5,7-triphenylhepta-4,6-diene-1,3-dione.
| Compound Name | (4E,6Z)-1,5,7-triphenylhepta-4,6-diene-1,3-dione |
|---|---|
| PubChem CID | 98547990 |
| Molecular Formula | C25H20O2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | (4E,6Z)-1,5,7-triphenylhepta-4,6-diene-1,3-dione |
| SMILES | O=C(/C=C(\C=C/c1ccccc1)c1ccccc1)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C25H20O2/c26-24(19-25(27)22-14-8-3-9-15-22)18-23(21-12-6-2-7-13-21)17-16-20-10-4-1-5-11-20/h1-18H,19H2/b17-16-,23-18+ |
| InChIKey | CIHNUILUZTVQRS-LDEAKCMXSA-N |
| XLogP | 5.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|