C28H40O2 — CID 98554233
(2Z)-2-[(5R)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-[(Z)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclohex-2-en-1-ylidene]acetic acid (PubChem CID 98554233) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (2Z)-2-[(5R)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-[(Z)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclohex-2-en-1-ylidene]acetic acid.
| Compound Name | (2Z)-2-[(5R)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-[(Z)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
|---|---|
| PubChem CID | 98554233 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (2Z)-2-[(5R)-5-(2,6,6-trimethylcyclohexen-1-yl)-3-[(Z)-2-(2,6,6-trimethylcyclohexen-1-yl)ethenyl]cyclohex-2-en-1-ylidene]acetic acid |
| SMILES | CC1=C(/C=C\C2=C/C(=C\C(=O)O)C[C@H](C3=C(C)CCCC3(C)C)C2)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H40O2/c1-19-9-7-13-27(3,4)24(19)12-11-21-15-22(18-25(29)30)17-23(16-21)26-20(2)10-8-14-28(26,5)6/h11-12,15,18,23H,7-10,13-14,16-17H2,1-6H3,(H,29,30)/b12-11-,22-18+/t23-/m1/s1 |
| InChIKey | OSJIOOWZMIEHAZ-GYUPKRNFSA-N |
| XLogP | 7.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|