C22H21Br — CID 98554806
(1S,2S,4S,5R)-7-bromo-3,3-dimethyl-2,4-diphenyltricyclo[3.3.0.02,4]oct-6-ene (PubChem CID 98554806) has the molecular formula C22H21Br and a molecular weight of 365.31 g/mol. Its IUPAC name is (1S,2S,4S,5R)-7-bromo-3,3-dimethyl-2,4-diphenyltricyclo[3.3.0.02,4]oct-6-ene.
| Compound Name | (1S,2S,4S,5R)-7-bromo-3,3-dimethyl-2,4-diphenyltricyclo[3.3.0.02,4]oct-6-ene |
|---|---|
| PubChem CID | 98554806 |
| Molecular Formula | C22H21Br |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | (1S,2S,4S,5R)-7-bromo-3,3-dimethyl-2,4-diphenyltricyclo[3.3.0.02,4]oct-6-ene |
| SMILES | CC1(C)[C@@]2(c3ccccc3)[C@H]3C=C(Br)C[C@@H]3[C@]12c1ccccc1 |
| InChI | InChI=1S/C22H21Br/c1-20(2)21(15-9-5-3-6-10-15)18-13-17(23)14-19(18)22(20,21)16-11-7-4-8-12-16/h3-13,18-19H,14H2,1-2H3/t18-,19-,21+,22+/m0/s1 |
| InChIKey | ZCUSLGXRRGHAJZ-SEIRJHJZSA-N |
| XLogP | 5.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |