C13H11N5O2 — CID 98666753
(Z)-3-amino-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]but-2-enenitrile (PubChem CID 98666753) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is (Z)-3-amino-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]but-2-enenitrile.
| Compound Name | (Z)-3-amino-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]but-2-enenitrile |
|---|---|
| PubChem CID | 98666753 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | (Z)-3-amino-2-[2-(4-oxo-1,2,3-benzotriazin-3-yl)acetyl]but-2-enenitrile |
| SMILES | C/C(N)=C(\C#N)C(=O)Cn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C13H11N5O2/c1-8(15)10(6-14)12(19)7-18-13(20)9-4-2-3-5-11(9)16-17-18/h2-5H,7,15H2,1H3/b10-8- |
| InChIKey | INTCMYMRTZDIPT-NTMALXAHSA-N |
| XLogP | 0.12 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|