C15H14Cl2N2O2S — CID 99607064
2,3-dichloro-N-(cyclopropylmethyl)-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 99607064) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is 2,3-dichloro-N-(cyclopropylmethyl)-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 2,3-dichloro-N-(cyclopropylmethyl)-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 99607064 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 2,3-dichloro-N-(cyclopropylmethyl)-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(Cl)c1Cl)N(CC1CC1)c1cccnc1 |
| InChI | InChI=1S/C15H14Cl2N2O2S/c16-13-4-1-5-14(15(13)17)22(20,21)19(10-11-6-7-11)12-3-2-8-18-9-12/h1-5,8-9,11H,6-7,10H2 |
| InChIKey | YTIBONFQOYNSKP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |