C19H29N3 — CID 99645025
(1S,11S)-7,7,11,13,13-pentamethyl-2,4-diazatetracyclo[7.5.1.11,11.05,15]hexadeca-2,5(15),9-trien-3-amine (PubChem CID 99645025) has the molecular formula C19H29N3 and a molecular weight of 299.46 g/mol. Its IUPAC name is (1S,11S)-7,7,11,13,13-pentamethyl-2,4-diazatetracyclo[7.5.1.11,11.05,15]hexadeca-2,5(15),9-trien-3-amine.
| Compound Name | (1S,11S)-7,7,11,13,13-pentamethyl-2,4-diazatetracyclo[7.5.1.11,11.05,15]hexadeca-2,5(15),9-trien-3-amine |
|---|---|
| PubChem CID | 99645025 |
| Molecular Formula | C19H29N3 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.24 |
| IUPAC Name | (1S,11S)-7,7,11,13,13-pentamethyl-2,4-diazatetracyclo[7.5.1.11,11.05,15]hexadeca-2,5(15),9-trien-3-amine |
| SMILES | CC1(C)CC2=C[C@@]3(C)CC(C)(C)C[C@@]4(C3)N=C(N)NC(=C24)C1 |
| InChI | InChI=1S/C19H29N3/c1-16(2)6-12-7-18(5)9-17(3,4)10-19(11-18)14(12)13(8-16)21-15(20)22-19/h7H,6,8-11H2,1-5H3,(H3,20,21,22)/t18-,19-/m0/s1 |
| InChIKey | VWBUZIGZZIPNTK-OALUTQOASA-N |
| XLogP | 3.87 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |