C14H14N2 — CID 4436
View drug profile → naphazoline2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole (PubChem CID 4436) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole.
| Compound Name | 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 4436 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 2-(naphthalen-1-ylmethyl)-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc2c(CC3=NCCN3)cccc2c1 |
| InChI | InChI=1S/C14H14N2/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14/h1-7H,8-10H2,(H,15,16) |
| InChIKey | CNIIGCLFLJGOGP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |