C20H21N3O4 — CID 3084726
View drug profile → amino(diphenylhydantoin) valeric acid2-amino-5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoic acid (PubChem CID 3084726) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 2-amino-5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoic acid.
| Compound Name | 2-amino-5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 3084726 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-amino-5-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)pentanoic acid |
| SMILES | NC(CCCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)C(=O)O |
| InChI | InChI=1S/C20H21N3O4/c21-16(17(24)25)12-7-13-23-18(26)20(22-19(23)27,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,16H,7,12-13,21H2,(H,22,27)(H,24,25) |
| InChIKey | PAJBBDCZSMDSFL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|