About oct-7-yn-4-amine
oct-7-yn-4-amine (PubChem CID 63656082) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is oct-7-yn-4-amine.
Molecular Properties
| Compound Name | oct-7-yn-4-amine |
| PubChem CID | 63656082 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | oct-7-yn-4-amine |
| SMILES | C#CCCC(N)CCC |
| InChI | InChI=1S/C8H15N/c1-3-5-7-8(9)6-4-2/h1,8H,4-7,9H2,2H3 |
| InChIKey | FBYVBKHHMFWRNN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze oct-7-yn-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oct-7-yn-4-amine?
The IUPAC name of oct-7-yn-4-amine (CID 63656082) is oct-7-yn-4-amine.
What is the SMILES notation for oct-7-yn-4-amine?
The canonical SMILES for oct-7-yn-4-amine is C#CCCC(N)CCC.
What is the InChIKey of oct-7-yn-4-amine?
The InChIKey is FBYVBKHHMFWRNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N/c1-3-5-7-8(9)6-4-2/h1,8H,4-7,9H2,2H3.
What are the key properties of oct-7-yn-4-amine?
oct-7-yn-4-amine has a molecular weight of 125.21 g/mol, XLogP of 1.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oct-7-yn-4-amine is sourced from PubChem (CID 63656082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).