C12H14N4O4S — CID 17134
View drug profile → sulfadoxine4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide (PubChem CID 17134) has the molecular formula C12H14N4O4S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide.
| Compound Name | 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 17134 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide |
| SMILES | COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC |
| InChI | InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) |
| InChIKey | PJSFRIWCGOHTNF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|