C18H15NO3 — CID 4614
View drug profile → oxaprozin3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid (PubChem CID 4614) has the molecular formula C18H15NO3 and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid.
| Compound Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
|---|---|
| PubChem CID | 4614 |
| Molecular Formula | C18H15NO3 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.11 |
| IUPAC Name | 3-(4,5-diphenyl-1,3-oxazol-2-yl)propanoic acid |
| SMILES | O=C(O)CCc1nc(-c2ccccc2)c(-c2ccccc2)o1 |
| InChI | InChI=1S/C18H15NO3/c20-16(21)12-11-15-19-17(13-7-3-1-4-8-13)18(22-15)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,21) |
| InChIKey | OFPXSFXSNFPTHF-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |