About 1-iodohexan-3-amine
1-iodohexan-3-amine (PubChem CID 126638870) has the molecular formula C6H14IN
and a molecular weight of 227.09 g/mol. Its IUPAC name is 1-iodohexan-3-amine.
Molecular Properties
| Compound Name | 1-iodohexan-3-amine |
| PubChem CID | 126638870 |
| Molecular Formula | C6H14IN |
| Molecular Weight | 227.09 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 1-iodohexan-3-amine |
| SMILES | CCCC(N)CCI |
| InChI | InChI=1S/C6H14IN/c1-2-3-6(8)4-5-7/h6H,2-5,8H2,1H3 |
| InChIKey | BJABAIFEQAEKNM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.09 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-iodohexan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodohexan-3-amine?
The IUPAC name of 1-iodohexan-3-amine (CID 126638870) is 1-iodohexan-3-amine.
What is the SMILES notation for 1-iodohexan-3-amine?
The canonical SMILES for 1-iodohexan-3-amine is CCCC(N)CCI.
What is the InChIKey of 1-iodohexan-3-amine?
The InChIKey is BJABAIFEQAEKNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14IN/c1-2-3-6(8)4-5-7/h6H,2-5,8H2,1H3.
What are the key properties of 1-iodohexan-3-amine?
1-iodohexan-3-amine has a molecular weight of 227.09 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodohexan-3-amine is sourced from PubChem (CID 126638870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).