C23H46O4Si2 — CID 10003496
[(1R,4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-yl] acetate (PubChem CID 10003496) has the molecular formula C23H46O4Si2 and a molecular weight of 442.79 g/mol. Its IUPAC name is [(1R,4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-yl] acetate.
| Compound Name | [(1R,4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10003496 |
| Molecular Formula | C23H46O4Si2 |
| Molecular Weight | 442.79 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | [(1R,4R,5S,6R,7R)-4-[tert-butyl(dimethyl)silyl]oxy-5,7-dimethyl-6-triethylsilyloxycyclohept-2-en-1-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C=C[C@@H](OC(C)=O)[C@H]1C |
| InChI | InChI=1S/C23H46O4Si2/c1-12-29(13-2,14-3)27-22-17(4)20(25-19(6)24)15-16-21(18(22)5)26-28(10,11)23(7,8)9/h15-18,20-22H,12-14H2,1-11H3/t17-,18+,20-,21-,22-/m1/s1 |
| InChIKey | MKSDQAARMXYYGT-HVYFLLBWSA-N |
| XLogP | 6.54 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.79 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|