C25H24N2O5S — CID 10027450
4-naphthalen-1-yl-2-sulfanylidene-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (PubChem CID 10027450) has the molecular formula C25H24N2O5S and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-naphthalen-1-yl-2-sulfanylidene-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile.
| Compound Name | 4-naphthalen-1-yl-2-sulfanylidene-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10027450 |
| Molecular Formula | C25H24N2O5S |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-naphthalen-1-yl-2-sulfanylidene-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2cccc3ccccc23)c2c(n([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c1=S)CCC2 |
| InChI | InChI=1S/C25H24N2O5S/c26-11-17-20(15-8-3-6-13-5-1-2-7-14(13)15)16-9-4-10-18(16)27(25(17)33)24-23(31)22(30)21(29)19(12-28)32-24/h1-3,5-8,19,21-24,28-31H,4,9-10,12H2/t19-,21-,22+,23-,24-/m1/s1 |
| InChIKey | GXGLWCZQHQSBTO-PFKOEMKTSA-N |
| XLogP | 2.37 |
| TPSA | 118.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|