C11H10BrClN4O3S — CID 10046114
1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea (PubChem CID 10046114) has the molecular formula C11H10BrClN4O3S and a molecular weight of 393.65 g/mol. Its IUPAC name is 1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea.
| Compound Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 10046114 |
| Molecular Formula | C11H10BrClN4O3S |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 391.93 |
| IUPAC Name | 1-(5-bromo-1,3,4-thiadiazol-2-yl)-3-(5-chloro-2,4-dimethoxyphenyl)urea |
| SMILES | COc1cc(OC)c(NC(=O)Nc2nnc(Br)s2)cc1Cl |
| InChI | InChI=1S/C11H10BrClN4O3S/c1-19-7-4-8(20-2)6(3-5(7)13)14-10(18)15-11-17-16-9(12)21-11/h3-4H,1-2H3,(H2,14,15,17,18) |
| InChIKey | BOLHGVDWUKUFBO-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |