C21H25NO3S2 — CID 10046774
(E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-5-phenylsulfanylpent-4-en-1-one (PubChem CID 10046774) has the molecular formula C21H25NO3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-5-phenylsulfanylpent-4-en-1-one.
| Compound Name | (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-5-phenylsulfanylpent-4-en-1-one |
|---|---|
| PubChem CID | 10046774 |
| Molecular Formula | C21H25NO3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-5-phenylsulfanylpent-4-en-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]13[C@@H](C2)OC(=S)N3C(=O)C[C@@H](O)/C=C/Sc1ccccc1 |
| InChI | InChI=1S/C21H25NO3S2/c1-20(2)14-8-10-21(20)17(12-14)25-19(26)22(21)18(24)13-15(23)9-11-27-16-6-4-3-5-7-16/h3-7,9,11,14-15,17,23H,8,10,12-13H2,1-2H3/b11-9+/t14-,15+,17-,21-/m1/s1 |
| InChIKey | RQIQPUHDJJBIAI-XCVGNVQGSA-N |
| XLogP | 4.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|