C17H25NO3S — CID 10245650
(E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhept-4-en-1-one (PubChem CID 10245650) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhept-4-en-1-one.
| Compound Name | (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhept-4-en-1-one |
|---|---|
| PubChem CID | 10245650 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (E,3R)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhept-4-en-1-one |
| SMILES | CC/C=C/[C@H](O)CC(=O)N1C(=S)O[C@@H]2C[C@H]3CC[C@]21C3(C)C |
| InChI | InChI=1S/C17H25NO3S/c1-4-5-6-12(19)10-14(20)18-15(22)21-13-9-11-7-8-17(13,18)16(11,2)3/h5-6,11-13,19H,4,7-10H2,1-3H3/b6-5+/t11-,12+,13-,17-/m1/s1 |
| InChIKey | OVSQDIUQKZPYRT-HHNUNDILSA-N |
| XLogP | 2.79 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|