C16H23NO3S — CID 10086670
(E,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhex-4-en-1-one (PubChem CID 10086670) has the molecular formula C16H23NO3S and a molecular weight of 309.43 g/mol. Its IUPAC name is (E,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhex-4-en-1-one.
| Compound Name | (E,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhex-4-en-1-one |
|---|---|
| PubChem CID | 10086670 |
| Molecular Formula | C16H23NO3S |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | (E,3S)-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxyhex-4-en-1-one |
| SMILES | C/C=C/[C@@H](O)CC(=O)N1C(=S)O[C@@H]2C[C@H]3CC[C@]21C3(C)C |
| InChI | InChI=1S/C16H23NO3S/c1-4-5-11(18)9-13(19)17-14(21)20-12-8-10-6-7-16(12,17)15(10,2)3/h4-5,10-12,18H,6-9H2,1-3H3/b5-4+/t10-,11-,12-,16-/m1/s1 |
| InChIKey | KRVLMZIJINFWIT-IAIFAMFNSA-N |
| XLogP | 2.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|