C19H22BrNO3S — CID 10905978
(2R,3S)-2-bromo-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-3-phenylpropan-1-one (PubChem CID 10905978) has the molecular formula C19H22BrNO3S and a molecular weight of 424.36 g/mol. Its IUPAC name is (2R,3S)-2-bromo-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-3-phenylpropan-1-one.
| Compound Name | (2R,3S)-2-bromo-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 10905978 |
| Molecular Formula | C19H22BrNO3S |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | (2R,3S)-2-bromo-1-[(1S,5R,7R)-10,10-dimethyl-3-sulfanylidene-4-oxa-2-azatricyclo[5.2.1.01,5]decan-2-yl]-3-hydroxy-3-phenylpropan-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]13[C@@H](C2)OC(=S)N3C(=O)[C@H](Br)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H22BrNO3S/c1-18(2)12-8-9-19(18)13(10-12)24-17(25)21(19)16(23)14(20)15(22)11-6-4-3-5-7-11/h3-7,12-15,22H,8-10H2,1-2H3/t12-,13-,14-,15+,19-/m1/s1 |
| InChIKey | ROHARRVQVVKZIZ-DQQFRQOVSA-N |
| XLogP | 3.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|