C18H12BrFN4S — CID 1005872
(8S,8aS)-6-amino-8-(5-bromo-2-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,5,7-tricarbonitrile (PubChem CID 1005872) has the molecular formula C18H12BrFN4S and a molecular weight of 415.29 g/mol. Its IUPAC name is (8S,8aS)-6-amino-8-(5-bromo-2-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,5,7-tricarbonitrile.
| Compound Name | (8S,8aS)-6-amino-8-(5-bromo-2-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,5,7-tricarbonitrile |
|---|---|
| PubChem CID | 1005872 |
| Molecular Formula | C18H12BrFN4S |
| Molecular Weight | 415.29 g/mol |
| Exact Mass | 414.00 |
| IUPAC Name | (8S,8aS)-6-amino-8-(5-bromo-2-fluorophenyl)-1,3,8,8a-tetrahydroisothiochromene-5,5,7-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)C2=CCSC[C@H]2[C@@H]1c1cc(Br)ccc1F |
| InChI | InChI=1S/C18H12BrFN4S/c19-10-1-2-15(20)11(5-10)16-12(6-21)17(24)18(8-22,9-23)14-3-4-25-7-13(14)16/h1-3,5,13,16H,4,7,24H2/t13-,16-/m1/s1 |
| InChIKey | WPJAIQVCCFQKQO-CZUORRHYSA-N |
| XLogP | 3.74 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.29 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|