C20H26O4Se — CID 10070072
(1S,6S)-9-(methoxymethoxy)-3-phenylseleninyltricyclo[6.3.1.01,6]dodecan-2-one (PubChem CID 10070072) has the molecular formula C20H26O4Se and a molecular weight of 409.38 g/mol. Its IUPAC name is (1S,6S)-9-(methoxymethoxy)-3-phenylseleninyltricyclo[6.3.1.01,6]dodecan-2-one.
| Compound Name | (1S,6S)-9-(methoxymethoxy)-3-phenylseleninyltricyclo[6.3.1.01,6]dodecan-2-one |
|---|---|
| PubChem CID | 10070072 |
| Molecular Formula | C20H26O4Se |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (1S,6S)-9-(methoxymethoxy)-3-phenylseleninyltricyclo[6.3.1.01,6]dodecan-2-one |
| SMILES | COCOC1CC[C@]23CC1C[C@@H]2CCC([Se](=O)c1ccccc1)C3=O |
| InChI | InChI=1S/C20H26O4Se/c1-23-13-24-17-9-10-20-12-14(17)11-15(20)7-8-18(19(20)21)25(22)16-5-3-2-4-6-16/h2-6,14-15,17-18H,7-13H2,1H3/t14?,15-,17?,18?,20-,25?/m0/s1 |
| InChIKey | AGYZSNKCVNROBC-MSILNHOPSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|