C34H46O6 — CID 53381286
(2S,4R,4aR,5S,6R,8aR)-4-(methoxymethoxy)-5,8a-dimethyl-2-(3-oxobutyl)-6-phenylmethoxy-5-(2-phenylmethoxyethyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one (PubChem CID 53381286) has the molecular formula C34H46O6 and a molecular weight of 550.74 g/mol. Its IUPAC name is (2S,4R,4aR,5S,6R,8aR)-4-(methoxymethoxy)-5,8a-dimethyl-2-(3-oxobutyl)-6-phenylmethoxy-5-(2-phenylmethoxyethyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one.
| Compound Name | (2S,4R,4aR,5S,6R,8aR)-4-(methoxymethoxy)-5,8a-dimethyl-2-(3-oxobutyl)-6-phenylmethoxy-5-(2-phenylmethoxyethyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 53381286 |
| Molecular Formula | C34H46O6 |
| Molecular Weight | 550.74 g/mol |
| Exact Mass | 550.33 |
| IUPAC Name | (2S,4R,4aR,5S,6R,8aR)-4-(methoxymethoxy)-5,8a-dimethyl-2-(3-oxobutyl)-6-phenylmethoxy-5-(2-phenylmethoxyethyl)-3,4,4a,6,7,8-hexahydro-2H-naphthalen-1-one |
| SMILES | COCO[C@@H]1C[C@H](CCC(C)=O)C(=O)[C@]2(C)CC[C@@H](OCc3ccccc3)[C@@](C)(CCOCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C34H46O6/c1-25(35)15-16-28-21-29(40-24-37-4)31-33(2,19-20-38-22-26-11-7-5-8-12-26)30(17-18-34(31,3)32(28)36)39-23-27-13-9-6-10-14-27/h5-14,28-31H,15-24H2,1-4H3/t28-,29+,30+,31+,33+,34+/m0/s1 |
| InChIKey | DDGGQDKQKNKADQ-CXDHSSNGSA-N |
| XLogP | 6.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.74 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|