C23H17NO2S — CID 100928471
5-(4-nitrophenyl)spiro[2,5-dihydrothiopyran-6,9'-fluorene] (PubChem CID 100928471) has the molecular formula C23H17NO2S and a molecular weight of 371.46 g/mol. Its IUPAC name is 5-(4-nitrophenyl)spiro[2,5-dihydrothiopyran-6,9'-fluorene].
| Compound Name | 5-(4-nitrophenyl)spiro[2,5-dihydrothiopyran-6,9'-fluorene] |
|---|---|
| PubChem CID | 100928471 |
| Molecular Formula | C23H17NO2S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 5-(4-nitrophenyl)spiro[2,5-dihydrothiopyran-6,9'-fluorene] |
| SMILES | O=[N+]([O-])c1ccc(C2C=CCSC23c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C23H17NO2S/c25-24(26)17-13-11-16(12-14-17)20-10-5-15-27-23(20)21-8-3-1-6-18(21)19-7-2-4-9-22(19)23/h1-14,20H,15H2 |
| InChIKey | JSEXTDUNDWNEPR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|