C21H15N3O2 — CID 122365548
(4S)-4-(4-nitrophenyl)spiro[1,4-dihydroimidazole-5,9'-fluorene] (PubChem CID 122365548) has the molecular formula C21H15N3O2 and a molecular weight of 341.37 g/mol. Its IUPAC name is (4S)-4-(4-nitrophenyl)spiro[1,4-dihydroimidazole-5,9'-fluorene].
| Compound Name | (4S)-4-(4-nitrophenyl)spiro[1,4-dihydroimidazole-5,9'-fluorene] |
|---|---|
| PubChem CID | 122365548 |
| Molecular Formula | C21H15N3O2 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (4S)-4-(4-nitrophenyl)spiro[1,4-dihydroimidazole-5,9'-fluorene] |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2N=CNC23c2ccccc2-c2ccccc23)cc1 |
| InChI | InChI=1S/C21H15N3O2/c25-24(26)15-11-9-14(10-12-15)20-21(23-13-22-20)18-7-3-1-5-16(18)17-6-2-4-8-19(17)21/h1-13,20H,(H,22,23)/t20-/m0/s1 |
| InChIKey | KDZIZGLKBGVMCU-FQEVSTJZSA-N |
| XLogP | 4.19 |
| TPSA | 67.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|