C24H38N2O5Si — CID 100935704
ethyl (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3,6-diethoxy-2H-pyrazine-5-carboxylate (PubChem CID 100935704) has the molecular formula C24H38N2O5Si and a molecular weight of 462.66 g/mol. Its IUPAC name is ethyl (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3,6-diethoxy-2H-pyrazine-5-carboxylate.
| Compound Name | ethyl (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3,6-diethoxy-2H-pyrazine-5-carboxylate |
|---|---|
| PubChem CID | 100935704 |
| Molecular Formula | C24H38N2O5Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | ethyl (5R)-5-[(S)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-3,6-diethoxy-2H-pyrazine-5-carboxylate |
| SMILES | CCOC(=O)[C@]1([C@@H](O[Si](C)(C)C(C)(C)C)c2ccccc2)N=C(OCC)CN=C1OCC |
| InChI | InChI=1S/C24H38N2O5Si/c1-9-28-19-17-25-21(29-10-2)24(26-19,22(27)30-11-3)20(18-15-13-12-14-16-18)31-32(7,8)23(4,5)6/h12-16,20H,9-11,17H2,1-8H3/t20-,24+/m0/s1 |
| InChIKey | NNCRNUHZADNLTQ-GBXCKJPGSA-N |
| XLogP | 4.93 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|