C23H36O3 — CID 100936080
(3R,4R,6S)-3-(3,3-diethoxypropyl)-2-ethenyl-1,3-dimethyl-4-prop-1-en-2-yl-6-prop-2-ynoxycyclohexene (PubChem CID 100936080) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (3R,4R,6S)-3-(3,3-diethoxypropyl)-2-ethenyl-1,3-dimethyl-4-prop-1-en-2-yl-6-prop-2-ynoxycyclohexene.
| Compound Name | (3R,4R,6S)-3-(3,3-diethoxypropyl)-2-ethenyl-1,3-dimethyl-4-prop-1-en-2-yl-6-prop-2-ynoxycyclohexene |
|---|---|
| PubChem CID | 100936080 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (3R,4R,6S)-3-(3,3-diethoxypropyl)-2-ethenyl-1,3-dimethyl-4-prop-1-en-2-yl-6-prop-2-ynoxycyclohexene |
| SMILES | C#CCO[C@H]1C[C@H](C(=C)C)[C@@](C)(CCC(OCC)OCC)C(C=C)=C1C |
| InChI | InChI=1S/C23H36O3/c1-9-15-26-21-16-20(17(5)6)23(8,19(10-2)18(21)7)14-13-22(24-11-3)25-12-4/h1,10,20-22H,2,5,11-16H2,3-4,6-8H3/t20-,21+,23+/m1/s1 |
| InChIKey | UCVZYDDILIBCOW-GIWBLDEGSA-N |
| XLogP | 5.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|