C21H38O4 — CID 59987666
(4R,5R,6R)-5-(dimethoxymethyl)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-4-propan-2-ylcyclohexene (PubChem CID 59987666) has the molecular formula C21H38O4 and a molecular weight of 354.53 g/mol. Its IUPAC name is (4R,5R,6R)-5-(dimethoxymethyl)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-4-propan-2-ylcyclohexene.
| Compound Name | (4R,5R,6R)-5-(dimethoxymethyl)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-4-propan-2-ylcyclohexene |
|---|---|
| PubChem CID | 59987666 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | (4R,5R,6R)-5-(dimethoxymethyl)-6-[(2S,3S)-3-(methoxymethoxy)-2-methylpent-4-enyl]-1-methyl-4-propan-2-ylcyclohexene |
| SMILES | C=C[C@H](OCOC)[C@@H](C)C[C@H]1C(C)=CC[C@H](C(C)C)[C@H]1C(OC)OC |
| InChI | InChI=1S/C21H38O4/c1-9-19(25-13-22-6)16(5)12-18-15(4)10-11-17(14(2)3)20(18)21(23-7)24-8/h9-10,14,16-21H,1,11-13H2,2-8H3/t16-,17+,18-,19-,20+/m0/s1 |
| InChIKey | UENIVNKBOGNQIC-LJDSDSDDSA-N |
| XLogP | 4.66 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|