C19H30O3S2 — CID 100947724
4-(1-ethoxyethoxy)-1-(4-phenylsulfanylthian-4-yl)butan-1-ol (PubChem CID 100947724) has the molecular formula C19H30O3S2 and a molecular weight of 370.58 g/mol. Its IUPAC name is 4-(1-ethoxyethoxy)-1-(4-phenylsulfanylthian-4-yl)butan-1-ol.
| Compound Name | 4-(1-ethoxyethoxy)-1-(4-phenylsulfanylthian-4-yl)butan-1-ol |
|---|---|
| PubChem CID | 100947724 |
| Molecular Formula | C19H30O3S2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-(1-ethoxyethoxy)-1-(4-phenylsulfanylthian-4-yl)butan-1-ol |
| SMILES | CCOC(C)OCCCC(O)C1(Sc2ccccc2)CCSCC1 |
| InChI | InChI=1S/C19H30O3S2/c1-3-21-16(2)22-13-7-10-18(20)19(11-14-23-15-12-19)24-17-8-5-4-6-9-17/h4-6,8-9,16,18,20H,3,7,10-15H2,1-2H3 |
| InChIKey | GUKXMHPRESHPIW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|