C30H38N4OS — CID 10097584
N,N-diethyl-4-[(R)-(4-prop-2-enylpiperazin-1-yl)-[3-(thiophen-2-ylmethylamino)phenyl]methyl]benzamide (PubChem CID 10097584) has the molecular formula C30H38N4OS and a molecular weight of 502.73 g/mol. Its IUPAC name is N,N-diethyl-4-[(R)-(4-prop-2-enylpiperazin-1-yl)-[3-(thiophen-2-ylmethylamino)phenyl]methyl]benzamide.
| Compound Name | N,N-diethyl-4-[(R)-(4-prop-2-enylpiperazin-1-yl)-[3-(thiophen-2-ylmethylamino)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 10097584 |
| Molecular Formula | C30H38N4OS |
| Molecular Weight | 502.73 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | N,N-diethyl-4-[(R)-(4-prop-2-enylpiperazin-1-yl)-[3-(thiophen-2-ylmethylamino)phenyl]methyl]benzamide |
| SMILES | C=CCN1CCN([C@H](c2ccc(C(=O)N(CC)CC)cc2)c2cccc(NCc3cccs3)c2)CC1 |
| InChI | InChI=1S/C30H38N4OS/c1-4-16-32-17-19-34(20-18-32)29(24-12-14-25(15-13-24)30(35)33(5-2)6-3)26-9-7-10-27(22-26)31-23-28-11-8-21-36-28/h4,7-15,21-22,29,31H,1,5-6,16-20,23H2,2-3H3/t29-/m1/s1 |
| InChIKey | AQJJNADLVMPTFV-GDLZYMKVSA-N |
| XLogP | 5.74 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.73 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|