C18H19NOS — CID 100978436
2-[(5S,7R)-spiro[adamantane-2,2'-oxirane]-1-yl]-1,3-benzothiazole (PubChem CID 100978436) has the molecular formula C18H19NOS and a molecular weight of 297.42 g/mol. Its IUPAC name is 2-[(5S,7R)-spiro[adamantane-2,2'-oxirane]-1-yl]-1,3-benzothiazole.
| Compound Name | 2-[(5S,7R)-spiro[adamantane-2,2'-oxirane]-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 100978436 |
| Molecular Formula | C18H19NOS |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-[(5S,7R)-spiro[adamantane-2,2'-oxirane]-1-yl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(C34C[C@@H]5CC(C[C@@H](C5)C3)C43CO3)nc2c1 |
| InChI | InChI=1S/C18H19NOS/c1-2-4-15-14(3-1)19-16(21-15)17-8-11-5-12(9-17)7-13(6-11)18(17)10-20-18/h1-4,11-13H,5-10H2/t11-,12+,13?,17?,18? |
| InChIKey | XWNFTVKVYOFTBF-HNHPRNNJSA-N |
| XLogP | 4.14 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|