C29H31NO4S — CID 136828612
5-[5-(1-adamantyl)-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]-2-(1,3-benzothiazol-2-yl)phenol (PubChem CID 136828612) has the molecular formula C29H31NO4S and a molecular weight of 489.64 g/mol. Its IUPAC name is 5-[5-(1-adamantyl)-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]-2-(1,3-benzothiazol-2-yl)phenol.
| Compound Name | 5-[5-(1-adamantyl)-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]-2-(1,3-benzothiazol-2-yl)phenol |
|---|---|
| PubChem CID | 136828612 |
| Molecular Formula | C29H31NO4S |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 5-[5-(1-adamantyl)-4,4-dimethyl-2,6,7-trioxabicyclo[3.2.0]heptan-1-yl]-2-(1,3-benzothiazol-2-yl)phenol |
| SMILES | CC1(C)COC2(c3ccc(-c4nc5ccccc5s4)c(O)c3)OOC12C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C29H31NO4S/c1-26(2)16-32-28(29(26,34-33-28)27-13-17-9-18(14-27)11-19(10-17)15-27)20-7-8-21(23(31)12-20)25-30-22-5-3-4-6-24(22)35-25/h3-8,12,17-19,31H,9-11,13-16H2,1-2H3 |
| InChIKey | KSPIWWAQPRMLSU-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|