C5H2FN4O6+ — CID 100982146
1-fluoro-2,4,6-trinitropyridin-1-ium (PubChem CID 100982146) has the molecular formula C5H2FN4O6+ and a molecular weight of 233.09 g/mol. Its IUPAC name is 1-fluoro-2,4,6-trinitropyridin-1-ium.
| Compound Name | 1-fluoro-2,4,6-trinitropyridin-1-ium |
|---|---|
| PubChem CID | 100982146 |
| Molecular Formula | C5H2FN4O6+ |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 1-fluoro-2,4,6-trinitropyridin-1-ium |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])[n+](F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C5H2FN4O6/c6-7-4(9(13)14)1-3(8(11)12)2-5(7)10(15)16/h1-2H/q+1 |
| InChIKey | QLASNWUTJRECDB-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 133.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|