C32H43NO4Si — CID 100993211
(4S)-4-tert-butyl-3-[(2E,5S,7R)-5-[dimethyl(phenyl)silyl]-7-phenylmethoxydeca-2,9-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 100993211) has the molecular formula C32H43NO4Si and a molecular weight of 533.79 g/mol. Its IUPAC name is (4S)-4-tert-butyl-3-[(2E,5S,7R)-5-[dimethyl(phenyl)silyl]-7-phenylmethoxydeca-2,9-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-tert-butyl-3-[(2E,5S,7R)-5-[dimethyl(phenyl)silyl]-7-phenylmethoxydeca-2,9-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 100993211 |
| Molecular Formula | C32H43NO4Si |
| Molecular Weight | 533.79 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | (4S)-4-tert-butyl-3-[(2E,5S,7R)-5-[dimethyl(phenyl)silyl]-7-phenylmethoxydeca-2,9-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | C=CC[C@H](C[C@H](C/C=C/C(=O)N1C(=O)OC[C@@H]1C(C)(C)C)[Si](C)(C)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C32H43NO4Si/c1-7-15-26(36-23-25-16-10-8-11-17-25)22-28(38(5,6)27-18-12-9-13-19-27)20-14-21-30(34)33-29(32(2,3)4)24-37-31(33)35/h7-14,16-19,21,26,28-29H,1,15,20,22-24H2,2-6H3/b21-14+/t26-,28+,29-/m1/s1 |
| InChIKey | XSYZURKLJOUXLO-MCNCDZDZSA-N |
| XLogP | 6.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.79 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|