C17H10 — CID 101044395
9-buta-1,2,3-trienylidenefluorene (PubChem CID 101044395) has the molecular formula C17H10 and a molecular weight of 214.27 g/mol. Its IUPAC name is 9-buta-1,2,3-trienylidenefluorene.
| Compound Name | 9-buta-1,2,3-trienylidenefluorene |
|---|---|
| PubChem CID | 101044395 |
| Molecular Formula | C17H10 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 9-buta-1,2,3-trienylidenefluorene |
| SMILES | C=C=C=C=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H10/c1-2-3-8-13-14-9-4-6-11-16(14)17-12-7-5-10-15(13)17/h4-7,9-12H,1H2 |
| InChIKey | CNALXZWAAANBDV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |