About 9-ethenylidenefluorene
9-ethenylidenefluorene (PubChem CID 11074207) has the molecular formula C15H10
and a molecular weight of 190.24 g/mol. Its IUPAC name is 9-ethenylidenefluorene.
Molecular Properties
| Compound Name | 9-ethenylidenefluorene |
| PubChem CID | 11074207 |
| Molecular Formula | C15H10 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | 9-ethenylidenefluorene |
| SMILES | C=C=C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C15H10/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15/h3-10H,1H2 |
| InChIKey | WLRABOXCJFWFKW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9-ethenylidenefluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethenylidenefluorene?
The IUPAC name of 9-ethenylidenefluorene (CID 11074207) is 9-ethenylidenefluorene.
What is the SMILES notation for 9-ethenylidenefluorene?
The canonical SMILES for 9-ethenylidenefluorene is C=C=C1c2ccccc2-c2ccccc21.
What is the InChIKey of 9-ethenylidenefluorene?
The InChIKey is WLRABOXCJFWFKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10/c1-2-11-12-7-3-5-9-14(12)15-10-6-4-8-13(11)15/h3-10H,1H2.
What are the key properties of 9-ethenylidenefluorene?
9-ethenylidenefluorene has a molecular weight of 190.24 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethenylidenefluorene is sourced from PubChem (CID 11074207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).