C7H11N5O3S4 — CID 101062746
morpholin-4-yl N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamodithioate (PubChem CID 101062746) has the molecular formula C7H11N5O3S4 and a molecular weight of 341.47 g/mol. Its IUPAC name is morpholin-4-yl N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamodithioate.
| Compound Name | morpholin-4-yl N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 101062746 |
| Molecular Formula | C7H11N5O3S4 |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | morpholin-4-yl N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)carbamodithioate |
| SMILES | NS(=O)(=O)c1nnc(NC(=S)SN2CCOCC2)s1 |
| InChI | InChI=1S/C7H11N5O3S4/c8-19(13,14)7-11-10-5(17-7)9-6(16)18-12-1-3-15-4-2-12/h1-4H2,(H2,8,13,14)(H,9,10,16) |
| InChIKey | AKEWWICJDQOGSA-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|