C38H50O8 — CID 101111735
[(3S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4-bis(2-prop-2-enoyloxyethoxy)benzoate (PubChem CID 101111735) has the molecular formula C38H50O8 and a molecular weight of 634.81 g/mol. Its IUPAC name is [(3S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4-bis(2-prop-2-enoyloxyethoxy)benzoate.
| Compound Name | [(3S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4-bis(2-prop-2-enoyloxyethoxy)benzoate |
|---|---|
| PubChem CID | 101111735 |
| Molecular Formula | C38H50O8 |
| Molecular Weight | 634.81 g/mol |
| Exact Mass | 634.35 |
| IUPAC Name | [(3S,8S,9S,10R,13R,14S,17S)-17-ethyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,4-bis(2-prop-2-enoyloxyethoxy)benzoate |
| SMILES | C=CC(=O)OCCOc1ccc(C(=O)O[C@H]2CC[C@@]3(C)C(=CC[C@H]4[C@@H]5CC[C@H](CC)[C@@]5(C)CC[C@@H]43)C2)cc1OCCOC(=O)C=C |
| InChI | InChI=1S/C38H50O8/c1-6-26-11-13-30-29-12-10-27-24-28(15-17-38(27,5)31(29)16-18-37(26,30)4)46-36(41)25-9-14-32(42-19-21-44-34(39)7-2)33(23-25)43-20-22-45-35(40)8-3/h7-10,14,23,26,28-31H,2-3,6,11-13,15-22,24H2,1,4-5H3/t26-,28-,29-,30-,31-,37+,38-/m0/s1 |
| InChIKey | GMBWSFUSPFUCLZ-QTJQUKKISA-N |
| XLogP | 7.42 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.81 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|