C25H36N2O8 — CID 101115469
methyl 2-[[(2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoyl]amino]acetate (PubChem CID 101115469) has the molecular formula C25H36N2O8 and a molecular weight of 492.57 g/mol. Its IUPAC name is methyl 2-[[(2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoyl]amino]acetate.
| Compound Name | methyl 2-[[(2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoyl]amino]acetate |
|---|---|
| PubChem CID | 101115469 |
| Molecular Formula | C25H36N2O8 |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | methyl 2-[[(2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)[C@H](C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H36N2O8/c1-14(15-10-8-7-9-11-15)27-16(22(29)26-13-18(28)30-6)12-17-19-20(33-24(2,3)32-19)21-23(31-17)35-25(4,5)34-21/h7-11,14,16-17,19-21,23,27H,12-13H2,1-6H3,(H,26,29)/t14-,16-,17+,19-,20-,21+,23+/m0/s1 |
| InChIKey | MWTAKSBUIOCXKK-BXPFPKEZSA-N |
| XLogP | 1.78 |
| TPSA | 113.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |