C33H51N4O7P — CID 101121739
N-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethyl]-2-[(5R,7S)-3-(4-nitrophenyl)-1-adamantyl]acetamide (PubChem CID 101121739) has the molecular formula C33H51N4O7P and a molecular weight of 646.77 g/mol. Its IUPAC name is N-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethyl]-2-[(5R,7S)-3-(4-nitrophenyl)-1-adamantyl]acetamide.
| Compound Name | N-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethyl]-2-[(5R,7S)-3-(4-nitrophenyl)-1-adamantyl]acetamide |
|---|---|
| PubChem CID | 101121739 |
| Molecular Formula | C33H51N4O7P |
| Molecular Weight | 646.77 g/mol |
| Exact Mass | 646.35 |
| IUPAC Name | N-[2-[2-[2-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxyethoxy]ethoxy]ethyl]-2-[(5R,7S)-3-(4-nitrophenyl)-1-adamantyl]acetamide |
| SMILES | CC(C)N(C(C)C)P(OCCC#N)OCCOCCOCCNC(=O)CC12C[C@H]3C[C@@H](C1)CC(c1ccc([N+](=O)[O-])cc1)(C3)C2 |
| InChI | InChI=1S/C33H51N4O7P/c1-25(2)36(26(3)4)45(43-12-5-10-34)44-17-16-42-15-14-41-13-11-35-31(38)23-32-19-27-18-28(20-32)22-33(21-27,24-32)29-6-8-30(9-7-29)37(39)40/h6-9,25-28H,5,11-24H2,1-4H3,(H,35,38)/t27-,28+,32?,33?,45? |
| InChIKey | KTJJCFHAHNZYGY-WSCSZUDCSA-N |
| XLogP | 6.26 |
| TPSA | 136.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.77 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|