C29H40O3Si — CID 101135541
tert-butyl-[2-[(1R,3S,5S)-1-(2-methylprop-2-enyl)-2,9-dioxabicyclo[3.3.1]nonan-3-yl]ethoxy]-diphenylsilane (PubChem CID 101135541) has the molecular formula C29H40O3Si and a molecular weight of 464.72 g/mol. Its IUPAC name is tert-butyl-[2-[(1R,3S,5S)-1-(2-methylprop-2-enyl)-2,9-dioxabicyclo[3.3.1]nonan-3-yl]ethoxy]-diphenylsilane.
| Compound Name | tert-butyl-[2-[(1R,3S,5S)-1-(2-methylprop-2-enyl)-2,9-dioxabicyclo[3.3.1]nonan-3-yl]ethoxy]-diphenylsilane |
|---|---|
| PubChem CID | 101135541 |
| Molecular Formula | C29H40O3Si |
| Molecular Weight | 464.72 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | tert-butyl-[2-[(1R,3S,5S)-1-(2-methylprop-2-enyl)-2,9-dioxabicyclo[3.3.1]nonan-3-yl]ethoxy]-diphenylsilane |
| SMILES | C=C(C)C[C@@]12CCC[C@@H](C[C@H](CCO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O1)O2 |
| InChI | InChI=1S/C29H40O3Si/c1-23(2)22-29-19-12-13-24(31-29)21-25(32-29)18-20-30-33(28(3,4)5,26-14-8-6-9-15-26)27-16-10-7-11-17-27/h6-11,14-17,24-25H,1,12-13,18-22H2,2-5H3/t24-,25-,29+/m0/s1 |
| InChIKey | PNNGSKPUEFGDMZ-IALVYGIMSA-N |
| XLogP | 5.97 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.72 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|