C27H24N2O3 — CID 101174849
(1S,2R,6R,8R,9R,12S,13R)-13-(4-nitrophenyl)-15-phenyl-7-oxa-14-azapentacyclo[6.5.3.19,12.01,8.02,6]heptadeca-4,10,14-triene (PubChem CID 101174849) has the molecular formula C27H24N2O3 and a molecular weight of 424.50 g/mol. Its IUPAC name is (1S,2R,6R,8R,9R,12S,13R)-13-(4-nitrophenyl)-15-phenyl-7-oxa-14-azapentacyclo[6.5.3.19,12.01,8.02,6]heptadeca-4,10,14-triene.
| Compound Name | (1S,2R,6R,8R,9R,12S,13R)-13-(4-nitrophenyl)-15-phenyl-7-oxa-14-azapentacyclo[6.5.3.19,12.01,8.02,6]heptadeca-4,10,14-triene |
|---|---|
| PubChem CID | 101174849 |
| Molecular Formula | C27H24N2O3 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (1S,2R,6R,8R,9R,12S,13R)-13-(4-nitrophenyl)-15-phenyl-7-oxa-14-azapentacyclo[6.5.3.19,12.01,8.02,6]heptadeca-4,10,14-triene |
| SMILES | O=[N+]([O-])c1ccc([C@H]2[C@@H]3C=C[C@@H](C3)[C@]34CC(c5ccccc5)=N[C@]23[C@H]2CC=C[C@H]2O4)cc1 |
| InChI | InChI=1S/C27H24N2O3/c30-29(31)21-13-10-18(11-14-21)25-19-9-12-20(15-19)26-16-23(17-5-2-1-3-6-17)28-27(25,26)22-7-4-8-24(22)32-26/h1-6,8-14,19-20,22,24-25H,7,15-16H2/t19-,20+,22+,24-,25+,26-,27-/m1/s1 |
| InChIKey | OFCQOTVEZYXMPG-KTLUADKHSA-N |
| XLogP | 5.23 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|