C29H52Si2 — CID 101194215
[3-cyclohexylidene-5-tri(propan-2-yl)silylpenta-1,4-diynyl]-tri(propan-2-yl)silane (PubChem CID 101194215) has the molecular formula C29H52Si2 and a molecular weight of 456.91 g/mol. Its IUPAC name is [3-cyclohexylidene-5-tri(propan-2-yl)silylpenta-1,4-diynyl]-tri(propan-2-yl)silane.
| Compound Name | [3-cyclohexylidene-5-tri(propan-2-yl)silylpenta-1,4-diynyl]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101194215 |
| Molecular Formula | C29H52Si2 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | [3-cyclohexylidene-5-tri(propan-2-yl)silylpenta-1,4-diynyl]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC(C#C[Si](C(C)C)(C(C)C)C(C)C)=C1CCCCC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C29H52Si2/c1-22(2)30(23(3)4,24(5)6)20-18-29(28-16-14-13-15-17-28)19-21-31(25(7)8,26(9)10)27(11)12/h22-27H,13-17H2,1-12H3 |
| InChIKey | SHTZRTZWCQTOLN-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|