C20H40Si4 — CID 101230238
trimethyl-[(3Z)-5-trimethylsilyl-2-(2-trimethylsilylethynyl)-3-(trimethylsilylmethylidene)pent-4-ynyl]silane (PubChem CID 101230238) has the molecular formula C20H40Si4 and a molecular weight of 392.88 g/mol. Its IUPAC name is trimethyl-[(3Z)-5-trimethylsilyl-2-(2-trimethylsilylethynyl)-3-(trimethylsilylmethylidene)pent-4-ynyl]silane.
| Compound Name | trimethyl-[(3Z)-5-trimethylsilyl-2-(2-trimethylsilylethynyl)-3-(trimethylsilylmethylidene)pent-4-ynyl]silane |
|---|---|
| PubChem CID | 101230238 |
| Molecular Formula | C20H40Si4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | trimethyl-[(3Z)-5-trimethylsilyl-2-(2-trimethylsilylethynyl)-3-(trimethylsilylmethylidene)pent-4-ynyl]silane |
| SMILES | C[Si](C)(C)C#C/C(=C\[Si](C)(C)C)C(C#C[Si](C)(C)C)C[Si](C)(C)C |
| InChI | InChI=1S/C20H40Si4/c1-21(2,3)15-13-19(17-23(7,8)9)20(18-24(10,11)12)14-16-22(4,5)6/h17,20H,18H2,1-12H3/b19-17+ |
| InChIKey | CQAYPMUENBUJAE-HTXNQAPBSA-N |
| XLogP | 6.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|