C48H50Si2 — CID 101253068
1,3,5-trimethyl-6-(2,4,6-trimethylphenyl)-5-[5,7,9-trimethyl-3-(2,4,6-trimethylphenyl)benzo[b][1]benzosilol-5-yl]benzo[b][1]benzosilole (PubChem CID 101253068) has the molecular formula C48H50Si2 and a molecular weight of 683.10 g/mol. Its IUPAC name is 1,3,5-trimethyl-6-(2,4,6-trimethylphenyl)-5-[5,7,9-trimethyl-3-(2,4,6-trimethylphenyl)benzo[b][1]benzosilol-5-yl]benzo[b][1]benzosilole.
| Compound Name | 1,3,5-trimethyl-6-(2,4,6-trimethylphenyl)-5-[5,7,9-trimethyl-3-(2,4,6-trimethylphenyl)benzo[b][1]benzosilol-5-yl]benzo[b][1]benzosilole |
|---|---|
| PubChem CID | 101253068 |
| Molecular Formula | C48H50Si2 |
| Molecular Weight | 683.10 g/mol |
| Exact Mass | 682.35 |
| IUPAC Name | 1,3,5-trimethyl-6-(2,4,6-trimethylphenyl)-5-[5,7,9-trimethyl-3-(2,4,6-trimethylphenyl)benzo[b][1]benzosilol-5-yl]benzo[b][1]benzosilole |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)[Si](C)([Si]2(C)c4cc(C)cc(C)c4-c4cccc(-c5c(C)cc(C)cc5C)c42)c2cc(C)cc(C)c2-3)c(C)c1 |
| InChI | InChI=1S/C48H50Si2/c1-27-18-31(5)44(32(6)19-27)37-16-17-38-41(26-37)49(11,42-24-29(3)22-35(9)46(38)42)50(12)43-25-30(4)23-36(10)47(43)40-15-13-14-39(48(40)50)45-33(7)20-28(2)21-34(45)8/h13-26H,1-12H3 |
| InChIKey | KSXOKQMCLCOSIA-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.10 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|