About CID 166443587
CID 166443587 (PubChem CID 166443587) has the molecular formula C50H56SnZn-
and a molecular weight of 841.10 g/mol.
Molecular Properties
| Compound Name | CID 166443587 |
| PubChem CID | 166443587 |
| Molecular Formula | C50H56SnZn- |
| Molecular Weight | 841.10 g/mol |
| Exact Mass | 840.27 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(-c2ccc(-c3c(C)cc(C)cc3C)c([Sn](C)c3cc(-c4c(C)cc(C)cc4C)ccc3-c3c(C)cc(C)cc3C)c2)c(C)c1.[CH3-].[Zn] |
| InChI | InChI=1S/2C24H25.2CH3.Sn.Zn/c2*1-15-11-17(3)23(18(4)12-15)21-7-9-22(10-8-21)24-19(5)13-16(2)14-20(24)6;;;;/h2*7-9,11-14H,1-6H3;2*1H3;;/q;;;-1;; |
| InChIKey | FBTOOQJOHIVUFX-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 841.10 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166443587 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166443587?
The IUPAC name of CID 166443587 (CID 166443587) is not available.
What is the SMILES notation for CID 166443587?
The canonical SMILES for CID 166443587 is Cc1cc(C)c(-c2ccc(-c3c(C)cc(C)cc3C)c([Sn](C)c3cc(-c4c(C)cc(C)cc4C)ccc3-c3c(C)cc(C)cc3C)c2)c(C)c1.[CH3-].[Zn].
What is the InChIKey of CID 166443587?
The InChIKey is FBTOOQJOHIVUFX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C24H25.2CH3.Sn.Zn/c2*1-15-11-17(3)23(18(4)12-15)21-7-9-22(10-8-21)24-19(5)13-16(2)14-20(24)6;;;;/h2*7-9,11-14H,1-6H3;2*1H3;;/q;;;-1;;.
What are the key properties of CID 166443587?
CID 166443587 has a molecular weight of 841.10 g/mol, XLogP of 12.74, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166443587 is sourced from PubChem (CID 166443587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).